Summing special object array of ints and objects - c#

I have a List<object> which can contain either an integer value or another List<object>.
What I need to do, is to sum the values in the array, depending on its depth(If depth is 0, multiply by 0, if 1 then by 1 ... etc.)
Example array: [5, 2, [7, -1], 3, [6, [-13, 8], 4]]
How it should be calculated: 5 + 2 + 2 * (7 - 1) + 3 + 2 * (6 + 3 * (-13 + 8) + 4) = 12
What I managed to get:
public class Program
{
public static List<object> TestCase1()
{
List<object> test = new List<object>(){
5,
2,
new List<object>(){
7, -1
},
3,
new List<object>(){
6,
new List<object>(){
-13, 8
},
4,
},
};
return test;
}
public static int ProductSum(List<object> array)
{
int depthCounter = 1;
int totalSum = 0;
int tempSum = 0;
for (int i = 0; i < array.Count; i++)
{
if (array[i] is IList<object>)
{
totalSum += tempSum * depthCounter;
tempSum = 0;
depthCounter++;
}
else
{
tempSum += (int)array[i];
}
}
return totalSum;
}
static void Main(string[] args)
{
Console.WriteLine("Result = " + ProductSum(TestCase1()));
}
}
The result from my code is
The problem that I have, is I don't see a way, that I could iterate through an array to calculate it ... Maybe there is a way to sort an array of objects in some way to simplify it?

The method should call itself ("recursive"), when it encounters a nested list. It should also take a depth parameter, keeping track of the depth. Every time you call the function recursively, you pass depth + 1 as the new depth. Whenever you count something, you multiply by depth.
public static int ProductSum(List<object> list) => ProductSum(list, 1);
public static int ProductSum(List<object> list, int depth)
{
var sum = 0;
foreach (var thing in list) {
if (thing is List<object> innerList) {
sum += ProductSum(innerList, depth + 1) * depth;
} else if (thing is int x) {
sum += x * depth;
}
}
return sum;
}

You should do it recusively:
public static int ProductSum(List<object> array, int depthCounter)
{
int totalSum = 0;
for (int i = 0; i < array.Count; i++)
{
if (array[i] is List<object>)
{
totalSum += ProductSum(array[i] as List<Object>, depthCounter + 1);
}
else
{
totalSum += (int)array[i] * depthCounter;
}
}
return totalSum;
}
You call it this way:
ProductSum(TestCase1(), 0);
But I don't get the number you calculated, though: If all depth 0 candidates are multiplied by 0, these are... 0! ;)
Maybe there are some rules for your application that I don't know, and that's the reason why the calculations differ, but in the code you see how recursions work.

Related

How does the size of IEnumerable get set? C#

I have some code that wasn't written by myself and I'm trying to use it to build a Poker ICM calculator program. This program takes an array of stack sizes and prize payouts and calculates each players prize equity.
The code works for 3 prizes but when I add a 4th prize I get an index out of bounds error because I'm trying to get permutation[3] when the object only contains indexes 0 to 2. The problem is I can't understand how the size of permuation gets set so I can't figure out how to adjust the code to work for higher numbers of prizes. I'd appreciate some help.
Below is a minimum working example with working and non-working code in the main method and a comment to indicate where the error occurs.
ICMCalculator.cs
class ICMCalculator
{
public double[] CalcEV(int[] structure, int[] chips)
{
//the probability of a players position
double[,] probabilitys = new double[structure.Length, chips.Length];
//the expected value of the player
double[] EVs = new double[chips.Length];
int[] players = new int[chips.Length];
for (int i = 0; i < players.Length; ++i)
players[i] = i;
IEnumerable<int[]> permutations;
for (int i = 0; i < structure.Length; ++i)
{
permutations = (new Permutation()).Enumerate(players, i + 2);
foreach (int[] permutation in permutations)
{
// OUT OF BOUNDS ERROR OCCURS HERE
probabilitys[i, permutation[i]] += CalcPermutationProbability(permutation, chips);
}
}
for (int i = 0; i < structure.Length; ++i)
{
for (int j = 0; j < chips.Length; ++j)
EVs[j] += probabilitys[i, j] * structure[i];
}
return EVs;
}
private double CalcPermutationProbability(int[] permutations, int[] chips)
{
double probability = 1.0F;
int chips_sum = chips.Sum();
for (int i = 0; i < permutations.Length; ++i)
{
probability *= System.Convert.ToDouble(chips[permutations[i]]) / System.Convert.ToDouble(chips_sum);
chips_sum -= chips[permutations[i]];
}
return probability;
}
}
Permutation.cs
class Permutation
{
public IEnumerable<T[]> Enumerate<T>(IEnumerable<T> nums, int length)
{
var perms = _GetPermutations<T>(new List<T>(), nums.ToList(), length);
return perms;
}
private IEnumerable<T[]> _GetPermutations<T>(IEnumerable<T> perm, IEnumerable<T> nums, int length)
{
if (length - perm.Count() <= 0)
{
yield return perm.ToArray();
}
else
{
foreach (var n in nums)
{
var result = _GetPermutations<T>(perm.Concat(new T[] { n }),
nums.Where(x => x.Equals(n) == false), length - perm.Count());
foreach (var xs in result)
yield return xs.ToArray();
}
}
}
}
Utils.cs
class Utils
{
public static string DoubleArrayToString(double[] doubles)
{
StringBuilder sb = new StringBuilder();
foreach (double dub in doubles)
{
sb.AppendLine(Utils.Format2DP(dub));
}
return sb.ToString().Trim();
}
}
Program.cs
static class Program
{
static void Main()
{
// THIS WORKS
ICMCalculator ev = new ICMCalculator();
int[] stacks = new int[] { 4500, 2700, 1800, 1000, 500 };
int[] prizes = new int[] { 84,36,18 };
int prizePool = prizes.Sum();
double[] equity = ev.CalcEV(prizes, stacks);
Console.WriteLine(Utils.DoubleArrayToString(equity));
// THIS THROWS INDEX ERROR
ev = new ICMCalculator();
stacks = new int[] { 4500, 2700, 1800, 1000, 500 };
prizes = new int[] { 84,36,18,9 };
prizePool = prizes.Sum();
equity = ev.CalcEV(prizes, stacks);
Console.WriteLine(Utils.DoubleArrayToString(equity));
}
}
To be clear, I believe that each 'permutation' should be the length of structure.Length. I don't want to avoid the out of bounds error by reducing the max value of i. I think I need to increase the size of each permuation to match structure.Length but I'm unable to figure out how to do this.
If resolved correctly, the code that currently fails should output the values: 50.82, 37.85, 29.16, 19.01, 10.15
I think the problem is in this line:
var result = _GetPermutations<T>(perm.Concat(new T[] { n }),
nums.Where(x => x.Equals(n) == false), length - perm.Count());
Instead, I think it should be
var result = _GetPermutations<T>(perm.Concat(new T[] { n }),
nums.Where(x => x.Equals(n) == false), length);
The problem here is that we are double-counting the length of the permutation found so far when we determine whether to stop further recursion.
The condition length - perm.Count() <= 0 (which can be simplified to perm.Count() >= length) is used to stop further calls to _GetPermutations if the permutation perm generated so far is long enough to be returned. This relies on the parameter length being the required length of the resulting permutations. However, by passing length - perm.Count() in the recursive call to _GetPermutations(), then we are reducing the value of length that inner calls to _GetPermutations() receive, causing them to stop the recursion early with permutations that are too short.

Interpolation Search, finding the closest value

i am trying to use an Interpolation Search algorithm to find a value and return it. (Which is what it does currently). I am trying to modify it so it returns a number which i can use to find the closest values to the inputted item if the item which was searched was not found within the array.
public static int InterSearch(double[] array, double data)
{
int size = array.Length;
int lo = 0;
int mid = -1;
int hi = array.Length - 1;
int index = -1;
int count = 0;
while (lo <= hi)
{
mid = (int)(lo + (((double)(hi - lo) / (array[hi] - array[lo])) * (data - array[lo])));
count++;
if (array[mid] == data)
{
index = mid;
break;
}
else
{
if (array[mid] < data)
lo = mid + 1;
else
hi = mid - 1;
}
}
return index;
}
You can use an aggregate that find the closest value.
this is a custom extension method but you get the idea.
public static double GetValueClosestTo(this List<double> values, double closestTo)
{
return values.Aggregate((x, y) => Math.Abs(x - closestTo) < Math.Abs(y - closestTo) ? x : y);
}
Let's say you have the following array {1, 5, 9.2, 6, 17} and you test the following number {6, 15, 5.2}. You will use the following code
var sourceArray = new [] {1, 5, 9.2, 6, 17}.ToList() // for simplicity i use a list
var closestToX = sourceArray.GetValueClosestTo(6); // this return 6
closestToX = sourceArray.GetValueClosestTo(15); // this return 17
closestToX = sourceArray.GetValueClosestTo(5.2); // this return 5

Fibonacci Sequence Error in C#

I've recently started learning C# (having learnt other languages) and I'm trying to create a function that generates the fibonacci sequence to the 'nth' term using a while loop and then returns the value of the 'nth' term.
My current code is this:
void fibonacci(int n)
{
int[] terms = { 0, 1 };
int i = 2;
while (i<=n)
{
terms.Concat( terms[i-1] + terms[i-2] );
i += 1;
}
return terms[n];
}
My understanding of C# is very poor as visual studio is telling me that I can't use 'Concat' with int[] - I'm trying to append the array with the new values. Any help would be great.
Arrays in C# are fixed length.
If you want to use a variable length collection, use a strongly typed List<T> instead, which has an Add method:
int fibonacci(int n)
{
var terms = new List<int>{ 0, 1 };
int i = 2;
while (i<=n)
{
terms.Add( terms[i-1] + terms[i-2] );
i += 1;
}
return terms[n];
}
You can't append to an array. In .Net, arrays have constant size and you can't resize them after creation.
Instead, you should use List<int> and its Add() method.
You can for example use list and change your code to:
int fibonacci(int n)
{
List<int> terms = new List<int> { 0, 1 };
int i = 2;
while (i<=n)
{
terms.Add(terms[i-1] + terms[i-2]);
i += 1;
}
return terms[n];
}
You can't add items to an array as it has fixed length. Use List<int> instead of array
I'm surprised nobody mentioned fixing the array size.
Well, maybe I'm missing something, but you could do:
int[] FibonacciArray(int n)
{
int[] F = new int[n+1];
F[0] = 0;
F[1] = 1;
for (int i = 2; i <= n; ++i)
{
F[i] = F[i - 1] + F[i - 2];
}
return F;
}
It's in average 2.5x faster than the version using a list.
But as often there is no free-lunch: the drawback is that your memory consumption is not smoothed: you pay upfront for all the memory you'll need.
Don't append values to an array. arrays have static size and you can't resize them after creation.
use
List<int> and its Add() method instead of array.
here is your solution for fibonacci series.
int fibonacci(int n)
{
var terms = new List<int>{ 0, 1 };
int i = 2;
while (i<=n)
{
terms.Add( terms[i-1] + terms[i-2] );
i += 1;
}
return terms[n];
}
also can be done like this :
class FibonacciSeries
{
static void Main(string[] args)
{
Console.WriteLine("Enter a num till which you want fibonacci series : ");
int val = Convert.ToInt32(Console.ReadLine());
int num1, num2;
num1 = num2 = 1;
Console.WriteLine(num1);
if (val > num2)
{
while (num2 < val)
{
Console.WriteLine(num2);
num2 += num1;
num1 = num2 - num1;
}
}
Console.ReadLine();
}
}
in your array format here is the solution
public int[] FibonacciSeriesArray(int num)
{
int[] arr = new int[num+1];
arr[0] = 0;
arr[1] = 1;
for (int startnum = 2; startnum <= num; startnum++)
{
arr[startnum] = arr[startnum - 1] + arr[startnum - 2];
}
return arr;
}
I would do it as a recursion, and not as a loop.
private static int fibonacci(int fib)
{
if (fib == 2 || fib == 1)
{
return 1;
}
else
{
return fibonacci(fib - 1) + fibonacci(fib - 2);
}
}
Here's a much more efficient way of finding fibonnaci numbers.
public static IEnumerable<double> FibList(int n)
{
for (int i = 1; i <= n; i++)
{
yield return Math.Round(Fib(i));
}
}
public static double Fib(double n)
{
double golden = 1.61803398875;
return (n == 0 || n == 1) ? 1 : (Math.Pow(golden, n) - Math.Pow(-golden, -n))/Math.Sqrt(5);
}

Given an array of integers. Find the LARGEST subarray with the MAXIMUM sum

Hi I am preparing for an interview code test and I stumbled across this question. I tried attempting it in C#, below is my embarrasing answer which I don't even know if it's right but mostly I guess not, could someone please kindly provide me with the answer so that when I rework on the solution I can at least have the answer to verify the output. Thanks.
Sample data:
int[] arr = {5, 1, -7, 3, 7};
Code:
int[] LargestsubarrayMaxSum(int[] arr)
{
int temp = 0;
int[] resultArr = new int[arr.Length];
for (int i = 0; i < arr.Length - 1; i++)
{
if (i != 0)
{
foreach (int item in resultArr)
{
temp += item;
}
if (temp + arr[i + 1] > 0)
{
resultArr[i + 1] = temp + arr[i + 1];
}
}
else
{
if ((arr[i] + arr[i + 1]) >= 0)
{
resultArr[i] = arr[i];
resultArr[i + 1] = arr[i] + arr[i + 1];
}
else
{
resultArr[i] = arr[i];
resultArr[i + 1] = 0;
}
}
}
return resultArr;
}
How about this?
var arr = new [] {5, 1, -7, 3, 7};
var xs =
from n in Enumerable.Range(0, arr.Length)
from l in Enumerable.Range(1, arr.Length - n)
let subseq = arr.Skip(n).Take(l)
orderby subseq.Count() descending
orderby subseq.Sum() descending
select subseq;
var maxSumSubseq = xs.First();
EDIT: Added orderby subseq.Count() descending to get maximal length subsequence.
EDIT: Added explanation as per comment.
Select all possible subsequence starting indices:
from n in Enumerable.Range(0, arr.Length)
Select all possible lengths of subsequences given the starting index:
from l in Enumerable.Range(1, arr.Length - n)
Extract the subsequence from the array:
let subseq = arr.Skip(n).Take(l)
Order subsequences by descending length (i.e. longest first) - could order by l instead of subseq.Count() but the latter is more expressive even though the former is more efficient:
orderby subseq.Count() descending
Calculate the sum of each subsequence and order the subsequences so highest valued sums are first:
orderby subseq.Sum() descending
Select the subsequences:
select subseq;
Only select the first subsequence - it's the highest value sum with the greatest length:
xs.First();
Hope this helps.
O(N) time complexity and O(1) space complexity. This is the optimal solution I know:
#include <stdio.h>
#include <limits.h>
int get_max_sum(int* array, int len, int* start, int* end)
{
int max_sum = INT_MIN, sum = 0, i;
int tmp_start = 0;
for(i = 0; i != len; ++i)
{
sum += array[i];
// if the sum is equal, choose the one with more elements
if(sum > max_sum || (sum == max_sum && (end - start) < (i - tmp_start)))
{
max_sum = sum;
*start = tmp_start;
*end = i;
}
if(sum < 0)
{
sum = 0;
tmp_start = i + 1;
}
}
return max_sum;
}
Here are some test cases:
int main(int argc, char **argv)
{
int arr1[] = {5, 1, -7, 3, 7};
int arr2[] = {1};
int arr3[] = {-1, -7, -3, -7};
int arr4[] = {5, 1, -7, 2, 2, 2};
int start, end, sum;
sum = get_max_sum(arr1, 5, &start, &end);
printf("sum: %d, start: %d, end: %d\n", sum, start, end);
sum = get_max_sum(arr2, 1, &start, &end);
printf("sum: %d, start: %d, end: %d\n", sum, start, end);
sum = get_max_sum(arr3, 4, &start, &end);
printf("sum: %d, start: %d, end: %d\n", sum, start, end);
sum = get_max_sum(arr4, 6, &start, &end);
printf("sum: %d, start: %d, end: %d\n", sum, start, end);
return 0;
}
$ ./a.out
sum: 10, start: 3, end: 4
sum: 1, start: 0, end: 0
sum: -1, start: 0, end: 0
sum: 6, start: 3, end: 5
Update1:
Added code to print the index of the subarray.
Update2:
If two sub arrays with the same sum are found, choose the one with more elements.
Update3:
Fix the algorithm for leading negative numbers
You could either use Enigmativity's answer but add the extra order by of subseq.Count() descending
or if you want an insane linq query......
int[] arr = .......
var result = new[]{0}
.Concat(arr.Select((x,i)=>new {x,i})
.Where(a=>a.x<0).Select(a=>a.i+1))
.Select (i => arr.Skip(i).TakeWhile(a => a>=0))
.OrderByDescending(a=>a.Sum())
.OrderByDescending(a=>a.Count()).First();
However usually you want to do these as a single loop..
var result=new List<int>();
var maxResult=new List<int>();
// These next four variables could be calculated on the fly
// but this way prevents reiterating the list each loop.
var count=0;
var sum=0;
var maxCount=0;
var maxSum=0;
foreach (var value in arr) {
if (value >=0) {
result.Add(value);
sum+=value;
count++;
} else {
if (sum>maxSum || (sum==maxSum && count>maxCount)) {
maxSum=sum;
maxCount=count;
maxResult=result;
}
result.Clear();
count=0;
sum=0;
}
}
var returnValue=maxResult.ToArray();
public static int[] FindMaxArrayEx(int[] srcArray)
{
int[] maxArray = new int[1];
int maxTotal = int.MinValue;
int curIndex = 0;
int tmpTotal = 0;
List<int> tmpArray = new List<int>();
if (srcArray.Length != 1)
{
for (int i = 0; i < srcArray.Length; i++)
{
tmpTotal = 0;
curIndex = i;
tmpArray.Clear();
while (curIndex < srcArray.Length)
{
tmpTotal += srcArray[curIndex];
tmpArray.Add(srcArray[curIndex]);
if (tmpTotal > maxTotal)
{
maxTotal = tmpTotal;
maxArray = tmpArray.ToArray();
}
curIndex++;
}
}
}
else
{
maxTotal = srcArray[0];
maxArray = srcArray;
}
Console.WriteLine("FindMaxArrayEx: {0}",maxTotal);
return maxArray;
}
Here is a totally working solution:
using System;
using System.Collections.Generic;
class MaxSumOfSubArray
{
static void Main()
{
//int[] array = { 2, 3, -6, -1, 2, -1, 6, 4, -8, 8 };
//maxSubSum(array);
int digits;
List<int> array = new List<int>();
Console.WriteLine("Please enter array of integer values. To exit, enter eny key different than 0..9");
while (int.TryParse(Console.ReadLine(), out digits))
{
array.Add(digits);
}
maxSubSum(array);
}
public static void maxSubSum(List<int> arr)
{
int maxSum = 0;
int currentSum = 0;
int i = 0;
int j = 0;
int seqStart=0;
int seqEnd=0;
while (j < arr.Count)
{
currentSum = currentSum + arr[j];
if (currentSum > maxSum)
{
maxSum = currentSum;
seqStart = i;
seqEnd = j;
}
else if (currentSum < 0)
{
i = j + 1;
currentSum = 0;
}
j++;
}
Console.Write("The sequence of maximal sum in given array is: {");
for (int seq = seqStart; seq <= seqEnd; seq++)
{
Console.Write(arr[seq] + " ");
}
Console.WriteLine("\b}");
Console.WriteLine("The maximum sum of subarray is: {0}", maxSum);
}
}
/// <summary>
/// given an non-empty input array of integers, this method returns the largest contiguous sum
/// </summary>
/// <param name="inputArray">the non-empty input array of integeres</param>
/// <returns>int, the largest contiguous sum</returns>
/// <remarks>time complexity O(n)</remarks>
static int GetLargestContiguousSum(int[] inputArray)
{
//find length of the string, if empty throw an exception
if (inputArray.Length == 0)
throw new ArgumentException("the input parameter cannot be an empty array");
int maxSum = 0;
int currentSum = 0;
maxSum = currentSum = inputArray[0];
for (int i = 1; i < inputArray.Length; i++) //skip i=0 as currentSum=inputArray[0].
{
currentSum = Math.Max(currentSum + inputArray[i], inputArray[i]);
maxSum = Math.Max(currentSum, maxSum);
}
return maxSum;
}
/*--This was the algorithum I found on Wiki to calculate sum, however to get the actual subarray
* I really had to think. After spending few hours I was able to solve it using startIndex and
* endIndex int variables and then by adding a if clause if (max_ending_here == array[i])
{ startIndex = i; }
* dang this was very tough. I hope you all will refactor as needed to make some improvements.*/
/* Initialize:
max_so_far = 0
max_ending_here = 0
Loop for each element of the array
(a) max_ending_here = max_ending_here + a[i]
(b) if(max_ending_here < 0)
max_ending_here = 0
(c) if(max_so_far < max_ending_here)
max_so_far = max_ending_here
return max_so_far*/
using System;
using System.Collections.Generic;
using System.Linq;
using System.Text;
namespace ConsoleApplication3
{
class Program
{
static void Main(string[] args)
{
int[] array = { -2, 1, -3, 4, -1, 2, 1, -5, 4 };
int[] largestSubArray;
largestSubArray = Max_Array(array);
Console.WriteLine();
Console.WriteLine("Subarray is :");
foreach (int numb in largestSubArray)
Console.WriteLine(numb);
Console.ReadKey();
}
//Max_Array function will calculate the largest contigent array
//sum and then find out startIndex and endIndex of sub array
//within for loop.Using this startIndex and endIndex new subarray
//is created with the name of largestSubArray and values are copied
//from original array.
public static int[] Max_Array(int[] array)
{
int[] largestSubArray;
int max_so_far = 0, max_ending_here = 0, startIndex = 0,
endIndex = 0;
for (int i = 0, j = 0; i < array.Length; i++)
{
max_ending_here += array[i];
if (max_ending_here <= 0)
{
max_ending_here = 0;
}
if (max_ending_here == array[i])
{ startIndex = i; }
if (max_so_far < max_ending_here)
{
max_so_far = max_ending_here;
endIndex = i;
}
}
Console.WriteLine("Largest sum is: {0}", max_so_far);
largestSubArray = new int[(endIndex - startIndex) + 1];
Array.Copy(array, startIndex, largestSubArray, 0, (endIndex - startIndex) + 1);
return largestSubArray;
}
}
}
Output
Largest sum is: 6
'Subarray is:
4,
-1,
2,
1'
It's not that complicated once you go over it. I thought about it going backwards at first, that helped for some reason.
If all numbers are positive (or 0), the entire array would be the largest subarray with max sum.
Now, we can take this fact and apply it over positive or negative arrays and instead say that we want to include all subarrays that are positive (or 0).
Start at the end and sum as you go left. When you find a negative number, you think, did that negative number make the rest of my sums worthless? if not, you keep going.. but you also mark that point right there as the current max sum (if it's greater than the last current max sum).
If they are worthless, (ie sum is now less than 0), you know that everything to the right of your index is now worthless. You still keep your current max sum in case thats the highest though.
start from 3 with your new index. Keep track of the indexes for your current max sum and end.
The SubArray with Maximum Sum in an Array is the Array without the Minimum most element element. So sort it. and remove the minimum element. thats it.
Thats applicable if Its Only Positive Integer Array. Otherwise the subarray of Positive elements only is the answer
below code working for me :
static void Main(string[] args)
{
string str = Console.ReadLine();
int [] arr = Array.ConvertAll(str.Split(' '),int.Parse);
int curSum = 0, maxSum = 0;
curSum = maxSum = arr[0];
for (int i = 1; i < arr.Length; i++)
{
curSum = Math.Max(curSum + arr[i], arr[i]);
maxSum = Math.Max(curSum, maxSum);
}
Console.WriteLine("{0}", maxSum);
Console.ReadKey();
}
Input : -2 1 -3 4 -1 2 1 -5 4
O/P: 6

Most elegant way to get the array element by position?

I have an array:
private int[,] _blocks = new int[6, 4];
It represents a set of blocks which is 6 deep horizontally and 4 deep vertically. Graphically it looks like this:
alt text http://www.angryhacker.com/toys/array.png
I need a function that would take in a number, from 1 to 24 and return the array element that matches. So for number 14, I'd get back _blocks[1, 2];
I've created a simplistic function:
private int GetBlockByPosition(int position)
{
int count = 0;
for (int i = 0; i < 6; i++)
{
for (int j = 0; j < 4; j++)
{
if (++count == position)
return _blocks[i, j];
}
}
return -1;
}
But this seems very wasteful and smells bad. Is there a more elegant and faster way?
Both in the horizontal direction and the vertical direction, you can see a pattern in your table of numbers. You can determine the horizontal position with position / 6 and a vertical position with position % 6 -- the modulo operation.
private int GetBlockByPosition(int position)
{
return _blocks[((position + 6) / 6) - 1, position % 6];
}
This makes mathematical sense. Division increases in chunks, and modulo (remainder on division) increases one by one. The math is pretty simple.
I'm not sure I follow, but why can't you just calculate he indexes based on the position? Something like this:
return _blocks[((position - 1) % 6),((position + 5) / 6) - 1];
I think you can do like this :
private int GetBlockByPosition(int position)
{
return _blocks[(position - 1 ) % 6 , (position - 1) / 6];
}
Are the numbers in your array ACTUALLY 1, 2, 3, ... or are you just using them as an example?
If there isn't any pattern to the data in your array that can be taken advantage of, then it looks like the simplistic option may be your best bet.
Or you could always make a one-time pass of the entire structure and build a hash table to be used in subsequent calls...
Depending on your definition of elegant, the following is perhaps a more functional way of solving the problem:
class Program
{
static void Main(string[] args)
{
var blocks = new int[,] {{1,2,3,4,5,6},{7,8,9,10,11,12},{13,14,15,16,17,18},{19,20,21,22,23,24}};
var position = blocks.FirstPositionOf(14);
Console.WriteLine(position.X + "," + position.Y + " has the element " + blocks[position.X,position.Y]);
}
}
class PositionTuple
{
public int X {get; set;}
public int Y {get; set;}
}
static class ArrayExtensions
{
public static IEnumerable<int> AsEnumerable(this int[,] someTwoDimensionalArray)
{
foreach (var num in someTwoDimensionalArray)
yield return num;
}
public static PositionTuple FirstPositionOf(this int[,] someTwoDimensionalArray, int someNumber)
{
return someTwoDimensionalArray
.AsEnumerable()
.Select((num, index) => new { Number = num, Tuple = new PositionTuple { X = index / (someTwoDimensionalArray.GetUpperBound(1) + 1), Y = index % (someTwoDimensionalArray.GetUpperBound(1)+1) }})
.Where(pair => pair.Number == someNumber)
.Select(pair => pair.Tuple)
.First();
}
}
I would make a more flexible function that can be used elsewhere if you need to
public static T Get2DArrayValueByPosition<T> (T[,] arr, int position)
{
// Gets the size of the array in first dimention
step = arr.GetUpperBound(0) + 1;
return arr[(position / step ), position % step];
}
Comprehensive solution considering the corner cases:
private int GetBlockByPosition(int position)
{
if(position % 6 == 0) { // last cells in each row. 6 gives [0,5]
return _blocks[(position / 6) - 1, (position - 1) % 6];
} else { // 11 gives [1,4]
return _blocks[position / 6 , (position % 6) - 1];
}
}
int result = GetByPosition(_blocks, 14);
private int GetByPosition(int[,] array, int position)
{
return GetByPositionBaseZero(array, position - 1);
}
private int GetByPositionBaseZero(int[,] array, int position)
{
int width = array.GetLength(0);
return array[position % width, position / width];
}

Categories

Resources